C34H26Cl2N4O6 — CID 90015377
2-(4-chlorophenoxy)-4,5-dihydroxybenzene-1,3-dicarbonitrile;2-(4-chlorophenoxy)-4,5-di(propan-2-yloxy)benzene-1,3-dicarbonitrile (PubChem CID 90015377) has the molecular formula C34H26Cl2N4O6 and a molecular weight of 657.51 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-4,5-dihydroxybenzene-1,3-dicarbonitrile;2-(4-chlorophenoxy)-4,5-di(propan-2-yloxy)benzene-1,3-dicarbonitrile.
| Compound Name | 2-(4-chlorophenoxy)-4,5-dihydroxybenzene-1,3-dicarbonitrile;2-(4-chlorophenoxy)-4,5-di(propan-2-yloxy)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90015377 |
| Molecular Formula | C34H26Cl2N4O6 |
| Molecular Weight | 657.51 g/mol |
| Exact Mass | 656.12 |
| IUPAC Name | 2-(4-chlorophenoxy)-4,5-dihydroxybenzene-1,3-dicarbonitrile;2-(4-chlorophenoxy)-4,5-di(propan-2-yloxy)benzene-1,3-dicarbonitrile |
| SMILES | CC(C)Oc1cc(C#N)c(Oc2ccc(Cl)cc2)c(C#N)c1OC(C)C.N#Cc1cc(O)c(O)c(C#N)c1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O3.C14H7ClN2O3/c1-12(2)24-18-9-14(10-22)19(17(11-23)20(18)25-13(3)4)26-16-7-5-15(21)6-8-16;15-9-1-3-10(4-2-9)20-14-8(6-16)5-12(18)13(19)11(14)7-17/h5-9,12-13H,1-4H3;1-5,18-19H |
| InChIKey | VRWUFXRYGYPFMC-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 172.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.51 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|