C23H22FN5O2S2 — CID 90015606
6-[[7-(3-fluoropiperidine-1-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one (PubChem CID 90015606) has the molecular formula C23H22FN5O2S2 and a molecular weight of 483.59 g/mol. Its IUPAC name is 6-[[7-(3-fluoropiperidine-1-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-[[7-(3-fluoropiperidine-1-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 90015606 |
| Molecular Formula | C23H22FN5O2S2 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 6-[[7-(3-fluoropiperidine-1-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one |
| SMILES | O=C(C1CCc2c(sc3ncnc(Nc4ccc5[nH]c(=O)sc5c4)c23)C1)N1CCCC(F)C1 |
| InChI | InChI=1S/C23H22FN5O2S2/c24-13-2-1-7-29(10-13)22(30)12-3-5-15-17(8-12)32-21-19(15)20(25-11-26-21)27-14-4-6-16-18(9-14)33-23(31)28-16/h4,6,9,11-13H,1-3,5,7-8,10H2,(H,28,31)(H,25,26,27) |
| InChIKey | JQZYLRJHGOQEMS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |