C16H24BrN3O3 — CID 9001571
2-[[(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-[[(2S)-butan-2-yl]carbamoyl]acetamide (PubChem CID 9001571) has the molecular formula C16H24BrN3O3 and a molecular weight of 386.29 g/mol. Its IUPAC name is 2-[[(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-[[(2S)-butan-2-yl]carbamoyl]acetamide.
| Compound Name | 2-[[(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-[[(2S)-butan-2-yl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 9001571 |
| Molecular Formula | C16H24BrN3O3 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[[(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-[[(2S)-butan-2-yl]carbamoyl]acetamide |
| SMILES | CC[C@H](C)NC(=O)NC(=O)CN[C@H](C)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C16H24BrN3O3/c1-5-10(2)19-16(22)20-15(21)9-18-11(3)12-6-7-14(23-4)13(17)8-12/h6-8,10-11,18H,5,9H2,1-4H3,(H2,19,20,21,22)/t10-,11+/m0/s1 |
| InChIKey | BGXHIHSQMNPTHA-WDEREUQCSA-N |
| XLogP | 2.73 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |