About 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile
4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile (PubChem CID 90016050) has the molecular formula C21H19F3N2O2S
and a molecular weight of 420.46 g/mol. Its IUPAC name is 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile |
| PubChem CID | 90016050 |
| Molecular Formula | C21H19F3N2O2S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile |
| SMILES | CC(C)Oc1cc(C#N)c(Sc2ccc(C(F)(F)F)cc2)c(C#N)c1OC(C)C |
| InChI | InChI=1S/C21H19F3N2O2S/c1-12(2)27-18-9-14(10-25)20(17(11-26)19(18)28-13(3)4)29-16-7-5-15(6-8-16)21(22,23)24/h5-9,12-13H,1-4H3 |
| InChIKey | YXEVTUHRRIKIBK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile?
The IUPAC name of 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile (CID 90016050) is 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile.
What is the SMILES notation for 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile?
The canonical SMILES for 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile is CC(C)Oc1cc(C#N)c(Sc2ccc(C(F)(F)F)cc2)c(C#N)c1OC(C)C.
What is the InChIKey of 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile?
The InChIKey is YXEVTUHRRIKIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3N2O2S/c1-12(2)27-18-9-14(10-25)20(17(11-26)19(18)28-13(3)4)29-16-7-5-15(6-8-16)21(22,23)24/h5-9,12-13H,1-4H3.
What are the key properties of 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile?
4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile has a molecular weight of 420.46 g/mol, XLogP of 6.17, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-di(propan-2-yloxy)-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene-1,3-dicarbonitrile is sourced from PubChem (CID 90016050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).