C13H17N5O — CID 90016691
6-(3-methoxypiperidin-1-yl)pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 90016691) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-(3-methoxypiperidin-1-yl)pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-(3-methoxypiperidin-1-yl)pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90016691 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 6-(3-methoxypiperidin-1-yl)pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | COC1CCCN(c2ccc3ncnc(N)c3n2)C1 |
| InChI | InChI=1S/C13H17N5O/c1-19-9-3-2-6-18(7-9)11-5-4-10-12(17-11)13(14)16-8-15-10/h4-5,8-9H,2-3,6-7H2,1H3,(H2,14,15,16) |
| InChIKey | LVXUEZYBYUTENJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |