About 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid
1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid (PubChem CID 90016983) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid |
| PubChem CID | 90016983 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid |
| SMILES | COC1(OC)CC(CC(C)O)(C(=O)O)C1 |
| InChI | InChI=1S/C10H18O5/c1-7(11)4-9(8(12)13)5-10(6-9,14-2)15-3/h7,11H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | FWDUMFBNURWGSS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid?
The IUPAC name of 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid (CID 90016983) is 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid?
The canonical SMILES for 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid is COC1(OC)CC(CC(C)O)(C(=O)O)C1.
What is the InChIKey of 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid?
The InChIKey is FWDUMFBNURWGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5/c1-7(11)4-9(8(12)13)5-10(6-9,14-2)15-3/h7,11H,4-6H2,1-3H3,(H,12,13).
What are the key properties of 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid?
1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid has a molecular weight of 218.25 g/mol, XLogP of 0.61, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxypropyl)-3,3-dimethoxycyclobutane-1-carboxylic acid is sourced from PubChem (CID 90016983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).