C19H22ClF2NO4S — CID 90017117
5-chloro-2-fluoro-4-[(3-fluoro-1-adamantyl)methoxy]-N-methylsulfonylbenzamide (PubChem CID 90017117) has the molecular formula C19H22ClF2NO4S and a molecular weight of 433.90 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[(3-fluoro-1-adamantyl)methoxy]-N-methylsulfonylbenzamide.
| Compound Name | 5-chloro-2-fluoro-4-[(3-fluoro-1-adamantyl)methoxy]-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 90017117 |
| Molecular Formula | C19H22ClF2NO4S |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 5-chloro-2-fluoro-4-[(3-fluoro-1-adamantyl)methoxy]-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(Cl)c(OCC23CC4CC(CC(F)(C4)C2)C3)cc1F |
| InChI | InChI=1S/C19H22ClF2NO4S/c1-28(25,26)23-17(24)13-3-14(20)16(4-15(13)21)27-10-18-5-11-2-12(6-18)8-19(22,7-11)9-18/h3-4,11-12H,2,5-10H2,1H3,(H,23,24) |
| InChIKey | VCBWMBWFXSHHTE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |