C17H21N7 — CID 90017261
5,6-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 90017261) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is 5,6-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5,6-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 90017261 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 5,6-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1ccc2nc(/C=C/c3nc(N4CCCC4)nn3C)nn2c1C |
| InChI | InChI=1S/C17H21N7/c1-12-6-8-16-18-14(20-24(16)13(12)2)7-9-15-19-17(21-22(15)3)23-10-4-5-11-23/h6-9H,4-5,10-11H2,1-3H3/b9-7+ |
| InChIKey | CSNVJIVPMGUJOO-VQHVLOKHSA-N |
| XLogP | 2.25 |
| TPSA | 64.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |