About 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid
5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid (PubChem CID 90017559) has the molecular formula C13H16BrClN2O2
and a molecular weight of 347.64 g/mol. Its IUPAC name is 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid.
Molecular Properties
| Compound Name | 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid |
| PubChem CID | 90017559 |
| Molecular Formula | C13H16BrClN2O2 |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid |
| SMILES | N#Cc1cc(Br)ccc1OCC1CCNCC1.OCl |
| InChI | InChI=1S/C13H15BrN2O.ClHO/c14-12-1-2-13(11(7-12)8-15)17-9-10-3-5-16-6-4-10;1-2/h1-2,7,10,16H,3-6,9H2;2H |
| InChIKey | MOLKCHWJWVOZIX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid?
The IUPAC name of 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid (CID 90017559) is 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid.
What is the SMILES notation for 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid?
The canonical SMILES for 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid is N#Cc1cc(Br)ccc1OCC1CCNCC1.OCl.
What is the InChIKey of 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid?
The InChIKey is MOLKCHWJWVOZIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2O.ClHO/c14-12-1-2-13(11(7-12)8-15)17-9-10-3-5-16-6-4-10;1-2/h1-2,7,10,16H,3-6,9H2;2H.
What are the key properties of 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid?
5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid has a molecular weight of 347.64 g/mol, XLogP of 2.83, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(piperidin-4-ylmethoxy)benzonitrile;hypochlorous acid is sourced from PubChem (CID 90017559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).