C16H20N8 — CID 90018218
5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-c]pyrimidine (PubChem CID 90018218) has the molecular formula C16H20N8 and a molecular weight of 324.39 g/mol. Its IUPAC name is 5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-c]pyrimidine.
| Compound Name | 5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-c]pyrimidine |
|---|---|
| PubChem CID | 90018218 |
| Molecular Formula | C16H20N8 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-c]pyrimidine |
| SMILES | Cc1cnc(C)n2nc(/C=C/c3nc(N4CCCC4)nn3C)nc12 |
| InChI | InChI=1S/C16H20N8/c1-11-10-17-12(2)24-15(11)18-13(20-24)6-7-14-19-16(21-22(14)3)23-8-4-5-9-23/h6-7,10H,4-5,8-9H2,1-3H3/b7-6+ |
| InChIKey | YCMZSNOJOXMYLH-VOTSOKGWSA-N |
| XLogP | 1.64 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |