C16H18N8 — CID 90018244
5,8-dimethyl-2-[2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethynyl]-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 90018244) has the molecular formula C16H18N8 and a molecular weight of 322.38 g/mol. Its IUPAC name is 5,8-dimethyl-2-[2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethynyl]-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 5,8-dimethyl-2-[2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethynyl]-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 90018244 |
| Molecular Formula | C16H18N8 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 5,8-dimethyl-2-[2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethynyl]-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | Cc1ncc(C)n2nc(C#Cc3nc(N4CCCC4)nn3C)nc12 |
| InChI | InChI=1S/C16H18N8/c1-11-10-17-12(2)15-18-13(20-24(11)15)6-7-14-19-16(21-22(14)3)23-8-4-5-9-23/h10H,4-5,8-9H2,1-3H3 |
| InChIKey | YSTXVWWARIOPJL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|