About 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride
2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride (PubChem CID 90018259) has the molecular formula C8H12Cl2N2
and a molecular weight of 207.10 g/mol. Its IUPAC name is 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride.
Molecular Properties
| Compound Name | 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride |
| PubChem CID | 90018259 |
| Molecular Formula | C8H12Cl2N2 |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride |
| SMILES | Cc1nc(C)c(CCl)nc1C.Cl |
| InChI | InChI=1S/C8H11ClN2.ClH/c1-5-6(2)11-8(4-9)7(3)10-5;/h4H2,1-3H3;1H |
| InChIKey | LCIONGSMCVJCOY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride?
The IUPAC name of 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride (CID 90018259) is 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride.
What is the SMILES notation for 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride?
The canonical SMILES for 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride is Cc1nc(C)c(CCl)nc1C.Cl.
What is the InChIKey of 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride?
The InChIKey is LCIONGSMCVJCOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2.ClH/c1-5-6(2)11-8(4-9)7(3)10-5;/h4H2,1-3H3;1H.
What are the key properties of 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride?
2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride has a molecular weight of 207.10 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-3,5,6-trimethylpyrazine;hydrochloride is sourced from PubChem (CID 90018259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).