C19H26N8 — CID 90018313
2-[2-[1-(cyclopropylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]ethyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 90018313) has the molecular formula C19H26N8 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-[2-[1-(cyclopropylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]ethyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 2-[2-[1-(cyclopropylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]ethyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 90018313 |
| Molecular Formula | C19H26N8 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-[2-[1-(cyclopropylmethyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]ethyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | Cc1ncc(C)n2nc(CCc3nc(N4CCCC4)n(CC4CC4)n3)nc12 |
| InChI | InChI=1S/C19H26N8/c1-13-11-20-14(2)18-21-16(24-27(13)18)7-8-17-22-19(25-9-3-4-10-25)26(23-17)12-15-5-6-15/h11,15H,3-10,12H2,1-2H3 |
| InChIKey | JTGBDLPQADNLIQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |