C26H33F2NO3 — CID 90018415
methyl 4-[4-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]phenyl]-3-fluorobenzoate (PubChem CID 90018415) has the molecular formula C26H33F2NO3 and a molecular weight of 445.55 g/mol. Its IUPAC name is methyl 4-[4-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]phenyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[4-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]phenyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 90018415 |
| Molecular Formula | C26H33F2NO3 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | methyl 4-[4-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]phenyl]-3-fluorobenzoate |
| SMILES | CCC(F)(CC)CN1CCC(COc2ccc(-c3ccc(C(=O)OC)cc3F)cc2)CC1 |
| InChI | InChI=1S/C26H33F2NO3/c1-4-26(28,5-2)18-29-14-12-19(13-15-29)17-32-22-9-6-20(7-10-22)23-11-8-21(16-24(23)27)25(30)31-3/h6-11,16,19H,4-5,12-15,17-18H2,1-3H3 |
| InChIKey | ITAWMLAWTYGWRD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |