C25H51NO5 — CID 90018499
(2R,3R,4R,5S)-6-[methyl-[(Z)-octadec-9-enyl]amino]hexane-1,2,3,4,5-pentol (PubChem CID 90018499) has the molecular formula C25H51NO5 and a molecular weight of 445.69 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[methyl-[(Z)-octadec-9-enyl]amino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[methyl-[(Z)-octadec-9-enyl]amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 90018499 |
| Molecular Formula | C25H51NO5 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.38 |
| IUPAC Name | (2R,3R,4R,5S)-6-[methyl-[(Z)-octadec-9-enyl]amino]hexane-1,2,3,4,5-pentol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C25H51NO5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(2)20-22(28)24(30)25(31)23(29)21-27/h10-11,22-25,27-31H,3-9,12-21H2,1-2H3/b11-10-/t22-,23+,24+,25+/m0/s1 |
| InChIKey | QNNDIEDWGDMQSN-XISRHIFPSA-N |
| XLogP | 3.39 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|