C15H19IO4 — CID 90019177
methyl (4S,5R)-2,2-diethyl-5-(2-iodophenyl)-1,3-dioxolane-4-carboxylate (PubChem CID 90019177) has the molecular formula C15H19IO4 and a molecular weight of 390.22 g/mol. Its IUPAC name is methyl (4S,5R)-2,2-diethyl-5-(2-iodophenyl)-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4S,5R)-2,2-diethyl-5-(2-iodophenyl)-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 90019177 |
| Molecular Formula | C15H19IO4 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | methyl (4S,5R)-2,2-diethyl-5-(2-iodophenyl)-1,3-dioxolane-4-carboxylate |
| SMILES | CCC1(CC)O[C@H](C(=O)OC)[C@@H](c2ccccc2I)O1 |
| InChI | InChI=1S/C15H19IO4/c1-4-15(5-2)19-12(13(20-15)14(17)18-3)10-8-6-7-9-11(10)16/h6-9,12-13H,4-5H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | VJLQHJGRBJZEPE-OLZOCXBDSA-N |
| XLogP | 3.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|