About (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine
(1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine (PubChem CID 90019205) has the molecular formula C5H9Cl2N
and a molecular weight of 154.04 g/mol. Its IUPAC name is (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine.
Molecular Properties
| Compound Name | (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine |
| PubChem CID | 90019205 |
| Molecular Formula | C5H9Cl2N |
| Molecular Weight | 154.04 g/mol |
| Exact Mass | 153.01 |
| IUPAC Name | (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine |
| SMILES | C[C@H](N)[C@@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C5H9Cl2N/c1-3(8)4-2-5(4,6)7/h3-4H,2,8H2,1H3/t3-,4-/m0/s1 |
| InChIKey | WVRXWJYIBMRGRY-IMJSIDKUSA-N |
| XLogP | 1.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.04 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine?
The IUPAC name of (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine (CID 90019205) is (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine.
What is the SMILES notation for (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine?
The canonical SMILES for (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine is C[C@H](N)[C@@H]1CC1(Cl)Cl.
What is the InChIKey of (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine?
The InChIKey is WVRXWJYIBMRGRY-IMJSIDKUSA-N. The full InChI is InChI=1S/C5H9Cl2N/c1-3(8)4-2-5(4,6)7/h3-4H,2,8H2,1H3/t3-,4-/m0/s1.
What are the key properties of (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine?
(1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine has a molecular weight of 154.04 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine is sourced from PubChem (CID 90019205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).