About 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide
4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide (PubChem CID 90019362) has the molecular formula C13H22ClO3P
and a molecular weight of 292.74 g/mol. Its IUPAC name is 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide.
Molecular Properties
| Compound Name | 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide |
| PubChem CID | 90019362 |
| Molecular Formula | C13H22ClO3P |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide |
| SMILES | CCCCC1=CP(=O)(OCC)OC(CCCCl)=C1 |
| InChI | InChI=1S/C13H22ClO3P/c1-3-5-7-12-10-13(8-6-9-14)17-18(15,11-12)16-4-2/h10-11H,3-9H2,1-2H3 |
| InChIKey | SPJYZEHLRJQACJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide?
The IUPAC name of 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide (CID 90019362) is 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide.
What is the SMILES notation for 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide?
The canonical SMILES for 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide is CCCCC1=CP(=O)(OCC)OC(CCCCl)=C1.
What is the InChIKey of 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide?
The InChIKey is SPJYZEHLRJQACJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22ClO3P/c1-3-5-7-12-10-13(8-6-9-14)17-18(15,11-12)16-4-2/h10-11H,3-9H2,1-2H3.
What are the key properties of 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide?
4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide has a molecular weight of 292.74 g/mol, XLogP of 5.22, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-6-(3-chloropropyl)-2-ethoxy-1,2λ5-oxaphosphinine 2-oxide is sourced from PubChem (CID 90019362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).