C3CeF6O — CID 90019366
cerium;1,1,1,3,3,3-hexafluoropropan-2-one (PubChem CID 90019366) has the molecular formula C3CeF6O and a molecular weight of 306.14 g/mol. Its IUPAC name is cerium;1,1,1,3,3,3-hexafluoropropan-2-one.
| Compound Name | cerium;1,1,1,3,3,3-hexafluoropropan-2-one |
|---|---|
| PubChem CID | 90019366 |
| Molecular Formula | C3CeF6O |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 305.89 |
| IUPAC Name | cerium;1,1,1,3,3,3-hexafluoropropan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(F)F.[Ce] |
| InChI | InChI=1S/C3F6O.Ce/c4-2(5,6)1(10)3(7,8)9; |
| InChIKey | AWMJZPRACCREMU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |