About [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride
[(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride (PubChem CID 90019608) has the molecular formula C5H10Cl3N
and a molecular weight of 190.50 g/mol. Its IUPAC name is [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride |
| PubChem CID | 90019608 |
| Molecular Formula | C5H10Cl3N |
| Molecular Weight | 190.50 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride |
| SMILES | C[C@H]1[C@@H](CN)C1(Cl)Cl.Cl |
| InChI | InChI=1S/C5H9Cl2N.ClH/c1-3-4(2-8)5(3,6)7;/h3-4H,2,8H2,1H3;1H/t3-,4+;/m0./s1 |
| InChIKey | NSVKAUSWIUCUAQ-RFKZQXLXSA-N |
| XLogP | 1.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride?
The IUPAC name of [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride (CID 90019608) is [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride.
What is the SMILES notation for [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride?
The canonical SMILES for [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride is C[C@H]1[C@@H](CN)C1(Cl)Cl.Cl.
What is the InChIKey of [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride?
The InChIKey is NSVKAUSWIUCUAQ-RFKZQXLXSA-N. The full InChI is InChI=1S/C5H9Cl2N.ClH/c1-3-4(2-8)5(3,6)7;/h3-4H,2,8H2,1H3;1H/t3-,4+;/m0./s1.
What are the key properties of [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride?
[(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride has a molecular weight of 190.50 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-2,2-dichloro-3-methylcyclopropyl]methanamine;hydrochloride is sourced from PubChem (CID 90019608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).