C12H16FN — CID 90019774
7-fluoro-1,1,3-trimethyl-2,3-dihydroinden-4-amine (PubChem CID 90019774) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is 7-fluoro-1,1,3-trimethyl-2,3-dihydroinden-4-amine.
| Compound Name | 7-fluoro-1,1,3-trimethyl-2,3-dihydroinden-4-amine |
|---|---|
| PubChem CID | 90019774 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 7-fluoro-1,1,3-trimethyl-2,3-dihydroinden-4-amine |
| SMILES | CC1CC(C)(C)c2c(F)ccc(N)c21 |
| InChI | InChI=1S/C12H16FN/c1-7-6-12(2,3)11-8(13)4-5-9(14)10(7)11/h4-5,7H,6,14H2,1-3H3 |
| InChIKey | USXBDIZEJAVICB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|