About 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane
5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane (PubChem CID 90020045) has the molecular formula C10H15F2NO
and a molecular weight of 203.23 g/mol. Its IUPAC name is 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane.
Molecular Properties
| Compound Name | 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane |
| PubChem CID | 90020045 |
| Molecular Formula | C10H15F2NO |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane |
| SMILES | CC12CC3(F)CC(CC(F)(C3)C1)N2O |
| InChI | InChI=1S/C10H15F2NO/c1-8-4-9(11)2-7(13(8)14)3-10(12,5-8)6-9/h7,14H,2-6H2,1H3 |
| InChIKey | HXHNFYPYIAGLHI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane?
The IUPAC name of 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane (CID 90020045) is 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane?
The canonical SMILES for 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane is CC12CC3(F)CC(CC(F)(C3)C1)N2O.
What is the InChIKey of 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane?
The InChIKey is HXHNFYPYIAGLHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2NO/c1-8-4-9(11)2-7(13(8)14)3-10(12,5-8)6-9/h7,14H,2-6H2,1H3.
What are the key properties of 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane?
5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane has a molecular weight of 203.23 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-2-hydroxy-1-methyl-2-azatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 90020045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).