C23H24FNO5 — CID 90020370
dibenzyl (2R,3R,4R)-3-fluoro-4-prop-2-enoxypyrrolidine-1,2-dicarboxylate (PubChem CID 90020370) has the molecular formula C23H24FNO5 and a molecular weight of 413.45 g/mol. Its IUPAC name is dibenzyl (2R,3R,4R)-3-fluoro-4-prop-2-enoxypyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl (2R,3R,4R)-3-fluoro-4-prop-2-enoxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90020370 |
| Molecular Formula | C23H24FNO5 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | dibenzyl (2R,3R,4R)-3-fluoro-4-prop-2-enoxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCO[C@@H]1CN(C(=O)OCc2ccccc2)[C@H](C(=O)OCc2ccccc2)[C@H]1F |
| InChI | InChI=1S/C23H24FNO5/c1-2-13-28-19-14-25(23(27)30-16-18-11-7-4-8-12-18)21(20(19)24)22(26)29-15-17-9-5-3-6-10-17/h2-12,19-21H,1,13-16H2/t19-,20+,21+/m1/s1 |
| InChIKey | UQBUKWWZHJSNGJ-HKBOAZHASA-N |
| XLogP | 3.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|