C9H8F5N3O3 — CID 90021817
2-(2-nitropyrrol-1-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide (PubChem CID 90021817) has the molecular formula C9H8F5N3O3 and a molecular weight of 301.17 g/mol. Its IUPAC name is 2-(2-nitropyrrol-1-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide.
| Compound Name | 2-(2-nitropyrrol-1-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide |
|---|---|
| PubChem CID | 90021817 |
| Molecular Formula | C9H8F5N3O3 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-(2-nitropyrrol-1-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide |
| SMILES | O=C(Cn1cccc1[N+](=O)[O-])NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F5N3O3/c10-8(11,9(12,13)14)5-15-6(18)4-16-3-1-2-7(16)17(19)20/h1-3H,4-5H2,(H,15,18) |
| InChIKey | OSPKTMHAEOKDHO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|