C21H15F3N2O3S2 — CID 90021864
2-(3-methylsulfonylphenyl)-4-[(2,4,6-trifluorophenyl)methyl]-1,2,4-benzothiadiazin-3-one (PubChem CID 90021864) has the molecular formula C21H15F3N2O3S2 and a molecular weight of 464.49 g/mol. Its IUPAC name is 2-(3-methylsulfonylphenyl)-4-[(2,4,6-trifluorophenyl)methyl]-1,2,4-benzothiadiazin-3-one.
| Compound Name | 2-(3-methylsulfonylphenyl)-4-[(2,4,6-trifluorophenyl)methyl]-1,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 90021864 |
| Molecular Formula | C21H15F3N2O3S2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 2-(3-methylsulfonylphenyl)-4-[(2,4,6-trifluorophenyl)methyl]-1,2,4-benzothiadiazin-3-one |
| SMILES | CS(=O)(=O)c1cccc(N2Sc3ccccc3N(Cc3c(F)cc(F)cc3F)C2=O)c1 |
| InChI | InChI=1S/C21H15F3N2O3S2/c1-31(28,29)15-6-4-5-14(11-15)26-21(27)25(19-7-2-3-8-20(19)30-26)12-16-17(23)9-13(22)10-18(16)24/h2-11H,12H2,1H3 |
| InChIKey | FYVDUFIEHAOVRM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|