C26H36ClFN4O3Si — CID 90021997
5-[(2-chloro-6-fluoro-3,5-dimethoxyanilino)methyl]-N-[cyclobutyl(2-trimethylsilylethoxy)methyl]-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 90021997) has the molecular formula C26H36ClFN4O3Si and a molecular weight of 535.14 g/mol. Its IUPAC name is 5-[(2-chloro-6-fluoro-3,5-dimethoxyanilino)methyl]-N-[cyclobutyl(2-trimethylsilylethoxy)methyl]-1H-pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 5-[(2-chloro-6-fluoro-3,5-dimethoxyanilino)methyl]-N-[cyclobutyl(2-trimethylsilylethoxy)methyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 90021997 |
| Molecular Formula | C26H36ClFN4O3Si |
| Molecular Weight | 535.14 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 5-[(2-chloro-6-fluoro-3,5-dimethoxyanilino)methyl]-N-[cyclobutyl(2-trimethylsilylethoxy)methyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | COc1cc(OC)c(Cl)c(NCc2cnc3[nH]ccc3c2NC(OCC[Si](C)(C)C)C2CCC2)c1F |
| InChI | InChI=1S/C26H36ClFN4O3Si/c1-33-19-13-20(34-2)22(28)24(21(19)27)30-14-17-15-31-25-18(9-10-29-25)23(17)32-26(16-7-6-8-16)35-11-12-36(3,4)5/h9-10,13,15-16,26,30H,6-8,11-12,14H2,1-5H3,(H2,29,31,32) |
| InChIKey | RXALAQPETJLNOC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 80.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.14 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|