About 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine
1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine (PubChem CID 90022352) has the molecular formula C14H25N4O+
and a molecular weight of 265.38 g/mol. Its IUPAC name is 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine.
Molecular Properties
| Compound Name | 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine |
| PubChem CID | 90022352 |
| Molecular Formula | C14H25N4O+ |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine |
| SMILES | CN(CC[N+]1(C)CCOCC1)c1ccc(N)cc1N |
| InChI | InChI=1S/C14H25N4O/c1-17(14-4-3-12(15)11-13(14)16)5-6-18(2)7-9-19-10-8-18/h3-4,11H,5-10,15-16H2,1-2H3/q+1 |
| InChIKey | FSBOYLHTBLRWBQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine?
The IUPAC name of 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine (CID 90022352) is 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine.
What is the SMILES notation for 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine?
The canonical SMILES for 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine is CN(CC[N+]1(C)CCOCC1)c1ccc(N)cc1N.
What is the InChIKey of 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine?
The InChIKey is FSBOYLHTBLRWBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N4O/c1-17(14-4-3-12(15)11-13(14)16)5-6-18(2)7-9-19-10-8-18/h3-4,11H,5-10,15-16H2,1-2H3/q+1.
What are the key properties of 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine?
1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine has a molecular weight of 265.38 g/mol, XLogP of 0.76, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methyl-1-N-[2-(4-methylmorpholin-4-ium-4-yl)ethyl]benzene-1,2,4-triamine is sourced from PubChem (CID 90022352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).