About N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid
N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid (PubChem CID 90022455) has the molecular formula C15H25Cl2N3O3
and a molecular weight of 366.29 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid.
Molecular Properties
| Compound Name | N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid |
| PubChem CID | 90022455 |
| Molecular Formula | C15H25Cl2N3O3 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid |
| SMILES | CN(CCCN)CCCN.COc1c(Cl)ccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C8H6Cl2O3.C7H19N3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;1-10(6-2-4-8)7-3-5-9/h2-3H,1H3,(H,11,12);2-9H2,1H3 |
| InChIKey | XNYCXKRWVHWIBE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid?
The IUPAC name of N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid (CID 90022455) is N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid.
What is the SMILES notation for N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid?
The canonical SMILES for N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid is CN(CCCN)CCCN.COc1c(Cl)ccc(Cl)c1C(=O)O.
What is the InChIKey of N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid?
The InChIKey is XNYCXKRWVHWIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2O3.C7H19N3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;1-10(6-2-4-8)7-3-5-9/h2-3H,1H3,(H,11,12);2-9H2,1H3.
What are the key properties of N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid?
N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid has a molecular weight of 366.29 g/mol, XLogP of 2.32, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;3,6-dichloro-2-methoxybenzoic acid is sourced from PubChem (CID 90022455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).