C24H17F2N3O2S — CID 90022561
4-[(2,6-difluorophenyl)methyl]-2-[(2-oxo-1H-quinolin-4-yl)methyl]-1,2,4-benzothiadiazin-3-one (PubChem CID 90022561) has the molecular formula C24H17F2N3O2S and a molecular weight of 449.48 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)methyl]-2-[(2-oxo-1H-quinolin-4-yl)methyl]-1,2,4-benzothiadiazin-3-one.
| Compound Name | 4-[(2,6-difluorophenyl)methyl]-2-[(2-oxo-1H-quinolin-4-yl)methyl]-1,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 90022561 |
| Molecular Formula | C24H17F2N3O2S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 4-[(2,6-difluorophenyl)methyl]-2-[(2-oxo-1H-quinolin-4-yl)methyl]-1,2,4-benzothiadiazin-3-one |
| SMILES | O=C1N(Cc2cc(=O)[nH]c3ccccc23)Sc2ccccc2N1Cc1c(F)cccc1F |
| InChI | InChI=1S/C24H17F2N3O2S/c25-18-7-5-8-19(26)17(18)14-28-21-10-3-4-11-22(21)32-29(24(28)31)13-15-12-23(30)27-20-9-2-1-6-16(15)20/h1-12H,13-14H2,(H,27,30) |
| InChIKey | DCLPFSXGDFAPHY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|