C22H18F2N2O2S2 — CID 90022694
4-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-(3-methylsulfanylphenyl)-1,2,4-benzothiadiazin-3-one (PubChem CID 90022694) has the molecular formula C22H18F2N2O2S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-(3-methylsulfanylphenyl)-1,2,4-benzothiadiazin-3-one.
| Compound Name | 4-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-(3-methylsulfanylphenyl)-1,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 90022694 |
| Molecular Formula | C22H18F2N2O2S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 4-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-(3-methylsulfanylphenyl)-1,2,4-benzothiadiazin-3-one |
| SMILES | COc1cc(F)c(CN2C(=O)N(c3cccc(SC)c3)Sc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C22H18F2N2O2S2/c1-28-15-11-18(23)17(19(24)12-15)13-25-20-8-3-4-9-21(20)30-26(22(25)27)14-6-5-7-16(10-14)29-2/h3-12H,13H2,1-2H3 |
| InChIKey | UGGZVYUQBSLMJQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|