About disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane
disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane (PubChem CID 90022851) has the molecular formula C4H9Na2O3PS
and a molecular weight of 214.13 g/mol. Its IUPAC name is disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane |
| PubChem CID | 90022851 |
| Molecular Formula | C4H9Na2O3PS |
| Molecular Weight | 214.13 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)COP([O-])([O-])=S.[Na+].[Na+] |
| InChI | InChI=1S/C4H11O3PS.2Na/c1-4(2)3-7-8(5,6)9;;/h4H,3H2,1-2H3,(H2,5,6,9);;/q;2*+1/p-2 |
| InChIKey | BJHUMOGXVBSVCL-UHFFFAOYSA-L |
| XLogP | -6.39 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.13 |
| LogP ≤ 5 | -6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane?
The IUPAC name of disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane (CID 90022851) is disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane.
What is the SMILES notation for disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane?
The canonical SMILES for disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane is CC(C)COP([O-])([O-])=S.[Na+].[Na+].
What is the InChIKey of disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane?
The InChIKey is BJHUMOGXVBSVCL-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H11O3PS.2Na/c1-4(2)3-7-8(5,6)9;;/h4H,3H2,1-2H3,(H2,5,6,9);;/q;2*+1/p-2.
What are the key properties of disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane?
disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane has a molecular weight of 214.13 g/mol, XLogP of -6.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-methylpropoxy-dioxido-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 90022851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).