C17H18N3OS2+ — CID 9002422
7-[[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 9002422) has the molecular formula C17H18N3OS2+ and a molecular weight of 344.49 g/mol. Its IUPAC name is 7-[[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 9002422 |
| Molecular Formula | C17H18N3OS2+ |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 7-[[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(C[NH+]2CCc3sccc3[C@H]2C2CC2)nc2sccn12 |
| InChI | InChI=1S/C17H17N3OS2/c21-15-9-12(18-17-20(15)6-8-23-17)10-19-5-3-14-13(4-7-22-14)16(19)11-1-2-11/h4,6-9,11,16H,1-3,5,10H2/p+1/t16-/m1/s1 |
| InChIKey | ANJVHAQFQPKBBQ-MRXNPFEDSA-O |
| XLogP | 1.91 |
| TPSA | 38.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |