C21H24N8 — CID 90024886
5,8-dimethyl-2-[2-(2-phenyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 90024886) has the molecular formula C21H24N8 and a molecular weight of 388.48 g/mol. Its IUPAC name is 5,8-dimethyl-2-[2-(2-phenyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 5,8-dimethyl-2-[2-(2-phenyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 90024886 |
| Molecular Formula | C21H24N8 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 5,8-dimethyl-2-[2-(2-phenyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | Cc1ncc(C)n2nc(CCc3nc(N4CCCC4)nn3-c3ccccc3)nc12 |
| InChI | InChI=1S/C21H24N8/c1-15-14-22-16(2)20-23-18(25-28(15)20)10-11-19-24-21(27-12-6-7-13-27)26-29(19)17-8-4-3-5-9-17/h3-5,8-9,14H,6-7,10-13H2,1-2H3 |
| InChIKey | TWAGIXGGYMXDRL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |