C17H22N8 — CID 90024951
5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)prop-1-enyl]-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 90024951) has the molecular formula C17H22N8 and a molecular weight of 338.42 g/mol. Its IUPAC name is 5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)prop-1-enyl]-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)prop-1-enyl]-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 90024951 |
| Molecular Formula | C17H22N8 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)prop-1-enyl]-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | C/C(=C\c1nc2c(C)ncc(C)n2n1)c1nc(N2CCCC2)nn1C |
| InChI | InChI=1S/C17H22N8/c1-11(15-20-17(22-23(15)4)24-7-5-6-8-24)9-14-19-16-13(3)18-10-12(2)25(16)21-14/h9-10H,5-8H2,1-4H3/b11-9+ |
| InChIKey | JOJTYCGNTUWTPM-PKNBQFBNSA-N |
| XLogP | 2.03 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |