C12H12BrN7 — CID 90025485
2-[(E)-2-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 90025485) has the molecular formula C12H12BrN7 and a molecular weight of 334.18 g/mol. Its IUPAC name is 2-[(E)-2-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-[(E)-2-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 90025485 |
| Molecular Formula | C12H12BrN7 |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-[(E)-2-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)n2nc(/C=C/c3nc(Br)nn3C)nc2n1 |
| InChI | InChI=1S/C12H12BrN7/c1-7-6-8(2)20-12(14-7)15-9(17-20)4-5-10-16-11(13)18-19(10)3/h4-6H,1-3H3/b5-4+ |
| InChIKey | CXZDMXCGKANPSE-SNAWJCMRSA-N |
| XLogP | 1.80 |
| TPSA | 73.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |