C58H92O3 — CID 90025586
2-[2,8-dimethyl-5-(3-methylbut-2-enyl)nona-2,7-dien-5-yl]oxy-2,3,3,5,6,6-hexakis(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)cyclohexane-1,4-dione (PubChem CID 90025586) has the molecular formula C58H92O3 and a molecular weight of 837.37 g/mol. Its IUPAC name is 2-[2,8-dimethyl-5-(3-methylbut-2-enyl)nona-2,7-dien-5-yl]oxy-2,3,3,5,6,6-hexakis(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)cyclohexane-1,4-dione.
| Compound Name | 2-[2,8-dimethyl-5-(3-methylbut-2-enyl)nona-2,7-dien-5-yl]oxy-2,3,3,5,6,6-hexakis(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)cyclohexane-1,4-dione |
|---|---|
| PubChem CID | 90025586 |
| Molecular Formula | C58H92O3 |
| Molecular Weight | 837.37 g/mol |
| Exact Mass | 836.70 |
| IUPAC Name | 2-[2,8-dimethyl-5-(3-methylbut-2-enyl)nona-2,7-dien-5-yl]oxy-2,3,3,5,6,6-hexakis(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)cyclohexane-1,4-dione |
| SMILES | CC(C)=CCCC1(CC=C(C)C)C(=O)C(CC=C(C)C)(CC=C(C)C)C(CC=C(C)C)(OC(CC=C(C)C)(CC=C(C)C)CC=C(C)C)C(=O)C1(CC=C(C)C)CC=C(C)C |
| InChI | InChI=1S/C58H92O3/c1-42(2)22-21-32-55(36-26-46(9)10)52(59)57(39-29-49(15)16,40-30-50(17)18)58(41-31-51(19)20,53(60)56(55,37-27-47(11)12)38-28-48(13)14)61-54(33-23-43(3)4,34-24-44(5)6)35-25-45(7)8/h22-31H,21,32-41H2,1-20H3 |
| InChIKey | NJZSPEOAONQBSS-UHFFFAOYSA-N |
| XLogP | 17.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.37 |
| LogP ≤ 5 | 17.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|