C22H31F2NO4 — CID 90025709
methyl 7-[(5R)-3,3-difluoro-5-[(E,4S)-4-methyl-3-oxonon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate (PubChem CID 90025709) has the molecular formula C22H31F2NO4 and a molecular weight of 411.49 g/mol. Its IUPAC name is methyl 7-[(5R)-3,3-difluoro-5-[(E,4S)-4-methyl-3-oxonon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(5R)-3,3-difluoro-5-[(E,4S)-4-methyl-3-oxonon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 90025709 |
| Molecular Formula | C22H31F2NO4 |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | methyl 7-[(5R)-3,3-difluoro-5-[(E,4S)-4-methyl-3-oxonon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCC#CC[C@H](C)C(=O)/C=C/[C@H]1CC(F)(F)C(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C22H31F2NO4/c1-4-5-8-11-17(2)19(26)14-13-18-16-22(23,24)21(28)25(18)15-10-7-6-9-12-20(27)29-3/h13-14,17-18H,4,6-7,9-12,15-16H2,1-3H3/b14-13+/t17-,18-/m0/s1 |
| InChIKey | OZYKGXZIIBUVQO-BFRYPLHYSA-N |
| XLogP | 3.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|