C17H23N3O2S — CID 90025915
4-[(2-oxopyrrolidine-1-carbothioyl)amino]-N-(2-phenylethyl)butanamide (PubChem CID 90025915) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 4-[(2-oxopyrrolidine-1-carbothioyl)amino]-N-(2-phenylethyl)butanamide.
| Compound Name | 4-[(2-oxopyrrolidine-1-carbothioyl)amino]-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 90025915 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-[(2-oxopyrrolidine-1-carbothioyl)amino]-N-(2-phenylethyl)butanamide |
| SMILES | O=C(CCCNC(=S)N1CCCC1=O)NCCc1ccccc1 |
| InChI | InChI=1S/C17H23N3O2S/c21-15(18-12-10-14-6-2-1-3-7-14)8-4-11-19-17(23)20-13-5-9-16(20)22/h1-3,6-7H,4-5,8-13H2,(H,18,21)(H,19,23) |
| InChIKey | YNJMCKQPRMMZKF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|