About CID 90026141
CID 90026141 (PubChem CID 90026141) has the molecular formula C14H13BrF2N2O2
and a molecular weight of 359.17 g/mol.
Molecular Properties
| Compound Name | CID 90026141 |
| PubChem CID | 90026141 |
| Molecular Formula | C14H13BrF2N2O2 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | — |
| SMILES | NC1=NC2(c3cc(Br)ccc3OCC23CC3)C(F)(F)CO1 |
| InChI | InChI=1S/C14H13BrF2N2O2/c15-8-1-2-10-9(5-8)14(12(3-4-12)6-20-10)13(16,17)7-21-11(18)19-14/h1-2,5H,3-4,6-7H2,(H2,18,19) |
| InChIKey | IZCQKTPKYGLDEA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 90026141 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90026141?
The IUPAC name of CID 90026141 (CID 90026141) is not available.
What is the SMILES notation for CID 90026141?
The canonical SMILES for CID 90026141 is NC1=NC2(c3cc(Br)ccc3OCC23CC3)C(F)(F)CO1.
What is the InChIKey of CID 90026141?
The InChIKey is IZCQKTPKYGLDEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrF2N2O2/c15-8-1-2-10-9(5-8)14(12(3-4-12)6-20-10)13(16,17)7-21-11(18)19-14/h1-2,5H,3-4,6-7H2,(H2,18,19).
What are the key properties of CID 90026141?
CID 90026141 has a molecular weight of 359.17 g/mol, XLogP of 2.80, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90026141 is sourced from PubChem (CID 90026141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).