About [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate
[3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate (PubChem CID 90026272) has the molecular formula C14H18FNO5S
and a molecular weight of 331.36 g/mol. Its IUPAC name is [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate.
Molecular Properties
| Compound Name | [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate |
| PubChem CID | 90026272 |
| Molecular Formula | C14H18FNO5S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OCC1OC2(CCCC2)OC1c1ccccc1F |
| InChI | InChI=1S/C14H18FNO5S/c15-11-6-2-1-5-10(11)13-12(9-19-22(16,17)18)20-14(21-13)7-3-4-8-14/h1-2,5-6,12-13H,3-4,7-9H2,(H2,16,17,18) |
| InChIKey | VKMLNJFIOWLBLW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate?
The IUPAC name of [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate (CID 90026272) is [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate.
What is the SMILES notation for [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate?
The canonical SMILES for [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate is NS(=O)(=O)OCC1OC2(CCCC2)OC1c1ccccc1F.
What is the InChIKey of [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate?
The InChIKey is VKMLNJFIOWLBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO5S/c15-11-6-2-1-5-10(11)13-12(9-19-22(16,17)18)20-14(21-13)7-3-4-8-14/h1-2,5-6,12-13H,3-4,7-9H2,(H2,16,17,18).
What are the key properties of [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate?
[3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate has a molecular weight of 331.36 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-fluorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate is sourced from PubChem (CID 90026272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).