C8H8N4O — CID 90026469
5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine-2-carbaldehyde (PubChem CID 90026469) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine-2-carbaldehyde.
| Compound Name | 5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 90026469 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine-2-carbaldehyde |
| SMILES | Cc1ncc(C)n2nc(C=O)nc12 |
| InChI | InChI=1S/C8H8N4O/c1-5-3-9-6(2)8-10-7(4-13)11-12(5)8/h3-4H,1-2H3 |
| InChIKey | WTHOAFOIMLIKPW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|