About methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate
methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate (PubChem CID 90026488) has the molecular formula C20H33F2NO4
and a molecular weight of 389.48 g/mol. Its IUPAC name is methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate |
| PubChem CID | 90026488 |
| Molecular Formula | C20H33F2NO4 |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCCCC[C@@H](O)C=CC1CC(F)(F)C(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C20H33F2NO4/c1-3-4-7-10-17(24)13-12-16-15-20(21,22)19(26)23(16)14-9-6-5-8-11-18(25)27-2/h12-13,16-17,24H,3-11,14-15H2,1-2H3/t16?,17-/m1/s1 |
| InChIKey | HHSQKMPZLSWQPP-ZYMOGRSISA-N |
| XLogP | 3.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate?
The IUPAC name of methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate (CID 90026488) is methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate.
What is the SMILES notation for methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate?
The canonical SMILES for methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate is CCCCC[C@@H](O)C=CC1CC(F)(F)C(=O)N1CCCCCCC(=O)OC.
What is the InChIKey of methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate?
The InChIKey is HHSQKMPZLSWQPP-ZYMOGRSISA-N. The full InChI is InChI=1S/C20H33F2NO4/c1-3-4-7-10-17(24)13-12-16-15-20(21,22)19(26)23(16)14-9-6-5-8-11-18(25)27-2/h12-13,16-17,24H,3-11,14-15H2,1-2H3/t16?,17-/m1/s1.
What are the key properties of methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate?
methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate has a molecular weight of 389.48 g/mol, XLogP of 3.84, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[3,3-difluoro-5-[(3R)-3-hydroxyoct-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate is sourced from PubChem (CID 90026488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).