C17H20ClN7 — CID 90026501
6-chloro-5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 90026501) has the molecular formula C17H20ClN7 and a molecular weight of 357.85 g/mol. Its IUPAC name is 6-chloro-5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-chloro-5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 90026501 |
| Molecular Formula | C17H20ClN7 |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 6-chloro-5,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cc(Cl)c(C)n2nc(/C=C/c3nc(N4CCCC4)nn3C)nc12 |
| InChI | InChI=1S/C17H20ClN7/c1-11-10-13(18)12(2)25-16(11)19-14(21-25)6-7-15-20-17(22-23(15)3)24-8-4-5-9-24/h6-7,10H,4-5,8-9H2,1-3H3/b7-6+ |
| InChIKey | OBPRDQDEZXTACT-VOTSOKGWSA-N |
| XLogP | 2.90 |
| TPSA | 64.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |