About N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide
N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide (PubChem CID 90027013) has the molecular formula C16H16FN3O
and a molecular weight of 285.32 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide |
| PubChem CID | 90027013 |
| Molecular Formula | C16H16FN3O |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide |
| SMILES | NC(N)=NC(=O)C(F)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16FN3O/c17-16(14(21)20-15(18)19,13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11H2,(H4,18,19,20,21) |
| InChIKey | JLJOEEFXUASXFR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide?
The IUPAC name of N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide (CID 90027013) is N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide.
What is the SMILES notation for N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide?
The canonical SMILES for N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide is NC(N)=NC(=O)C(F)(Cc1ccccc1)c1ccccc1.
What is the InChIKey of N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide?
The InChIKey is JLJOEEFXUASXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN3O/c17-16(14(21)20-15(18)19,13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11H2,(H4,18,19,20,21).
What are the key properties of N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide?
N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide has a molecular weight of 285.32 g/mol, XLogP of 1.89, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-2-fluoro-2,3-diphenylpropanamide is sourced from PubChem (CID 90027013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).