About 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one
1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one (PubChem CID 90027470) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one |
| PubChem CID | 90027470 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one |
| SMILES | CCN1CCCC1=O.CN1CCN(C)C1=O |
| InChI | InChI=1S/C6H11NO.C5H10N2O/c1-2-7-5-3-4-6(7)8;1-6-3-4-7(2)5(6)8/h2-5H2,1H3;3-4H2,1-2H3 |
| InChIKey | JLUXWXSATNUXBQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one?
The IUPAC name of 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one (CID 90027470) is 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one.
What is the SMILES notation for 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one?
The canonical SMILES for 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one is CCN1CCCC1=O.CN1CCN(C)C1=O.
What is the InChIKey of 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one?
The InChIKey is JLUXWXSATNUXBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C5H10N2O/c1-2-7-5-3-4-6(7)8;1-6-3-4-7(2)5(6)8/h2-5H2,1H3;3-4H2,1-2H3.
What are the key properties of 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one?
1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one has a molecular weight of 227.31 g/mol, XLogP of 0.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylimidazolidin-2-one;1-ethylpyrrolidin-2-one is sourced from PubChem (CID 90027470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).