C22H12F6N2 — CID 90027586
4-[[1,3,4,5,6,8-hexafluoro-7-(pyridin-4-ylmethyl)naphthalen-2-yl]methyl]pyridine (PubChem CID 90027586) has the molecular formula C22H12F6N2 and a molecular weight of 418.34 g/mol. Its IUPAC name is 4-[[1,3,4,5,6,8-hexafluoro-7-(pyridin-4-ylmethyl)naphthalen-2-yl]methyl]pyridine.
| Compound Name | 4-[[1,3,4,5,6,8-hexafluoro-7-(pyridin-4-ylmethyl)naphthalen-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 90027586 |
| Molecular Formula | C22H12F6N2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 4-[[1,3,4,5,6,8-hexafluoro-7-(pyridin-4-ylmethyl)naphthalen-2-yl]methyl]pyridine |
| SMILES | Fc1c(Cc2ccncc2)c(F)c2c(F)c(Cc3ccncc3)c(F)c(F)c2c1F |
| InChI | InChI=1S/C22H12F6N2/c23-17-13(9-11-1-5-29-6-2-11)19(25)21(27)16-15(17)18(24)14(20(26)22(16)28)10-12-3-7-30-8-4-12/h1-8H,9-10H2 |
| InChIKey | IXTRXPDBFCTYIA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|