About [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate
[5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate (PubChem CID 90027926) has the molecular formula C16H16N2O7S
and a molecular weight of 380.38 g/mol. Its IUPAC name is [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate.
Molecular Properties
| Compound Name | [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate |
| PubChem CID | 90027926 |
| Molecular Formula | C16H16N2O7S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OCC1OC(c2ccccc2)OC1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N2O7S/c17-26(21,22)23-10-14-15(12-8-4-5-9-13(12)18(19)20)25-16(24-14)11-6-2-1-3-7-11/h1-9,14-16H,10H2,(H2,17,21,22) |
| InChIKey | QXXREHAVUAFLBD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate?
The IUPAC name of [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate (CID 90027926) is [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate.
What is the SMILES notation for [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate?
The canonical SMILES for [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate is NS(=O)(=O)OCC1OC(c2ccccc2)OC1c1ccccc1[N+](=O)[O-].
What is the InChIKey of [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate?
The InChIKey is QXXREHAVUAFLBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O7S/c17-26(21,22)23-10-14-15(12-8-4-5-9-13(12)18(19)20)25-16(24-14)11-6-2-1-3-7-11/h1-9,14-16H,10H2,(H2,17,21,22).
What are the key properties of [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate?
[5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate has a molecular weight of 380.38 g/mol, XLogP of 1.97, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-nitrophenyl)-2-phenyl-1,3-dioxolan-4-yl]methyl sulfamate is sourced from PubChem (CID 90027926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).