About 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole
5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole (PubChem CID 90028561) has the molecular formula C20H22N6S
and a molecular weight of 378.51 g/mol. Its IUPAC name is 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole.
Molecular Properties
| Compound Name | 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole |
| PubChem CID | 90028561 |
| Molecular Formula | C20H22N6S |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole |
| SMILES | CCN1NNN=C1c1cnn(-c2ccccc2C)c1SCc1ccccc1 |
| InChI | InChI=1S/C20H22N6S/c1-3-25-19(22-23-24-25)17-13-21-26(18-12-8-7-9-15(18)2)20(17)27-14-16-10-5-4-6-11-16/h4-13,23-24H,3,14H2,1-2H3 |
| InChIKey | SLXGOEZYUMIFLG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole?
The IUPAC name of 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole (CID 90028561) is 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole.
What is the SMILES notation for 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole?
The canonical SMILES for 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole is CCN1NNN=C1c1cnn(-c2ccccc2C)c1SCc1ccccc1.
What is the InChIKey of 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole?
The InChIKey is SLXGOEZYUMIFLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N6S/c1-3-25-19(22-23-24-25)17-13-21-26(18-12-8-7-9-15(18)2)20(17)27-14-16-10-5-4-6-11-16/h4-13,23-24H,3,14H2,1-2H3.
What are the key properties of 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole?
5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole has a molecular weight of 378.51 g/mol, XLogP of 3.48, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-benzylsulfanyl-1-(2-methylphenyl)pyrazol-4-yl]-1-ethyl-2,3-dihydrotetrazole is sourced from PubChem (CID 90028561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).