About dimethylcarbamodithioic acid;1-phenylpyrazole
dimethylcarbamodithioic acid;1-phenylpyrazole (PubChem CID 90028772) has the molecular formula C12H15N3S2
and a molecular weight of 265.41 g/mol. Its IUPAC name is dimethylcarbamodithioic acid;1-phenylpyrazole.
Molecular Properties
| Compound Name | dimethylcarbamodithioic acid;1-phenylpyrazole |
| PubChem CID | 90028772 |
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | dimethylcarbamodithioic acid;1-phenylpyrazole |
| SMILES | CN(C)C(=S)S.c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C9H8N2.C3H7NS2/c1-2-5-9(6-3-1)11-8-4-7-10-11;1-4(2)3(5)6/h1-8H;1-2H3,(H,5,6) |
| InChIKey | CXZIDZLGJATJMP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 21.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dimethylcarbamodithioic acid;1-phenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylcarbamodithioic acid;1-phenylpyrazole?
The IUPAC name of dimethylcarbamodithioic acid;1-phenylpyrazole (CID 90028772) is dimethylcarbamodithioic acid;1-phenylpyrazole.
What is the SMILES notation for dimethylcarbamodithioic acid;1-phenylpyrazole?
The canonical SMILES for dimethylcarbamodithioic acid;1-phenylpyrazole is CN(C)C(=S)S.c1ccc(-n2cccn2)cc1.
What is the InChIKey of dimethylcarbamodithioic acid;1-phenylpyrazole?
The InChIKey is CXZIDZLGJATJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C3H7NS2/c1-2-5-9(6-3-1)11-8-4-7-10-11;1-4(2)3(5)6/h1-8H;1-2H3,(H,5,6).
What are the key properties of dimethylcarbamodithioic acid;1-phenylpyrazole?
dimethylcarbamodithioic acid;1-phenylpyrazole has a molecular weight of 265.41 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylcarbamodithioic acid;1-phenylpyrazole is sourced from PubChem (CID 90028772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).