About 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole
5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole (PubChem CID 90029070) has the molecular formula C7H11ClN6
and a molecular weight of 214.66 g/mol. Its IUPAC name is 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole.
Molecular Properties
| Compound Name | 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole |
| PubChem CID | 90029070 |
| Molecular Formula | C7H11ClN6 |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole |
| SMILES | CCN1NNN=C1c1cnn(C)c1Cl |
| InChI | InChI=1S/C7H11ClN6/c1-3-14-7(10-11-12-14)5-4-9-13(2)6(5)8/h4,11-12H,3H2,1-2H3 |
| InChIKey | OTLLCFAHGMTPDG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole?
The IUPAC name of 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole (CID 90029070) is 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole.
What is the SMILES notation for 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole?
The canonical SMILES for 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole is CCN1NNN=C1c1cnn(C)c1Cl.
What is the InChIKey of 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole?
The InChIKey is OTLLCFAHGMTPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN6/c1-3-14-7(10-11-12-14)5-4-9-13(2)6(5)8/h4,11-12H,3H2,1-2H3.
What are the key properties of 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole?
5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole has a molecular weight of 214.66 g/mol, XLogP of 0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chloro-1-methylpyrazol-4-yl)-1-ethyl-2,3-dihydrotetrazole is sourced from PubChem (CID 90029070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).